C14H16F4N2 — CID 171165437
1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enyl]piperazine (PubChem CID 171165437) has the molecular formula C14H16F4N2 and a molecular weight of 288.29 g/mol. Its IUPAC name is 1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171165437 |
| Molecular Formula | C14H16F4N2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enyl]piperazine |
| SMILES | C=C[C@@H](c1c(F)cccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H16F4N2/c1-2-12(20-8-6-19-7-9-20)13-10(14(16,17)18)4-3-5-11(13)15/h2-5,12,19H,1,6-9H2/t12-/m0/s1 |
| InChIKey | SXXYROPQDYTZKF-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|