C13H15ClF2N2 — CID 171172260
1-[(1R)-1-(4-chloro-2,6-difluorophenyl)prop-2-enyl]piperazine (PubChem CID 171172260) has the molecular formula C13H15ClF2N2 and a molecular weight of 272.73 g/mol. Its IUPAC name is 1-[(1R)-1-(4-chloro-2,6-difluorophenyl)prop-2-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-chloro-2,6-difluorophenyl)prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171172260 |
| Molecular Formula | C13H15ClF2N2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-[(1R)-1-(4-chloro-2,6-difluorophenyl)prop-2-enyl]piperazine |
| SMILES | C=C[C@H](c1c(F)cc(Cl)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF2N2/c1-2-12(18-5-3-17-4-6-18)13-10(15)7-9(14)8-11(13)16/h2,7-8,12,17H,1,3-6H2/t12-/m1/s1 |
| InChIKey | LGIAMKJCVHIPKE-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|