C13H16Cl2N2 — CID 171288389
1-[(1R)-1-(3,5-dichlorophenyl)prop-2-enyl]piperazine (PubChem CID 171288389) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 1-[(1R)-1-(3,5-dichlorophenyl)prop-2-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(3,5-dichlorophenyl)prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171288389 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-[(1R)-1-(3,5-dichlorophenyl)prop-2-enyl]piperazine |
| SMILES | C=C[C@H](c1cc(Cl)cc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H16Cl2N2/c1-2-13(17-5-3-16-4-6-17)10-7-11(14)9-12(15)8-10/h2,7-9,13,16H,1,3-6H2/t13-/m1/s1 |
| InChIKey | JKZBJPUTYNUNNW-CYBMUJFWSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|