C13H18Cl4N2O — CID 171272180
2,4-dichloro-6-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride (PubChem CID 171272180) has the molecular formula C13H18Cl4N2O and a molecular weight of 360.11 g/mol. Its IUPAC name is 2,4-dichloro-6-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride.
| Compound Name | 2,4-dichloro-6-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171272180 |
| Molecular Formula | C13H18Cl4N2O |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2,4-dichloro-6-[(1S)-1-piperazin-1-ylprop-2-enyl]phenol;dihydrochloride |
| SMILES | C=C[C@@H](c1cc(Cl)cc(Cl)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H16Cl2N2O.2ClH/c1-2-12(17-5-3-16-4-6-17)10-7-9(14)8-11(15)13(10)18;;/h2,7-8,12,16,18H,1,3-6H2;2*1H/t12-;;/m0../s1 |
| InChIKey | LTEUUOOHXCNNCF-LTCKWSDVSA-N |
| XLogP | 3.67 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|