C12H14Cl3F3N2O — CID 171174905
2,4-dichloro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride (PubChem CID 171174905) has the molecular formula C12H14Cl3F3N2O and a molecular weight of 365.61 g/mol. Its IUPAC name is 2,4-dichloro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride.
| Compound Name | 2,4-dichloro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171174905 |
| Molecular Formula | C12H14Cl3F3N2O |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2,4-dichloro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride |
| SMILES | Cl.Oc1c(Cl)cc(Cl)cc1[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H13Cl2F3N2O.ClH/c13-7-5-8(10(20)9(14)6-7)11(12(15,16)17)19-3-1-18-2-4-19;/h5-6,11,18,20H,1-4H2;1H/t11-;/m0./s1 |
| InChIKey | CTZOQJRBOFYLSN-MERQFXBCSA-N |
| XLogP | 3.63 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|