C12H13BrF4N2O — CID 171300320
4-bromo-2-fluoro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol (PubChem CID 171300320) has the molecular formula C12H13BrF4N2O and a molecular weight of 357.15 g/mol. Its IUPAC name is 4-bromo-2-fluoro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol.
| Compound Name | 4-bromo-2-fluoro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171300320 |
| Molecular Formula | C12H13BrF4N2O |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 4-bromo-2-fluoro-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
| SMILES | Oc1c(F)cc(Br)cc1[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H13BrF4N2O/c13-7-5-8(10(20)9(14)6-7)11(12(15,16)17)19-3-1-18-2-4-19/h5-6,11,18,20H,1-4H2/t11-/m0/s1 |
| InChIKey | IYGRMYJSOIGZOA-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|