C12H14BrF3N2O — CID 171174978
4-bromo-2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol (PubChem CID 171174978) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is 4-bromo-2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol.
| Compound Name | 4-bromo-2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171174978 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-bromo-2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
| SMILES | Oc1ccc(Br)cc1[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O/c13-8-1-2-10(19)9(7-8)11(12(14,15)16)18-5-3-17-4-6-18/h1-2,7,11,17,19H,3-6H2/t11-/m0/s1 |
| InChIKey | KYPNICLJPPWTCM-NSHDSACASA-N |
| XLogP | 2.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|