C13H16BrF3N2 — CID 171179200
1-[(1R)-1-(5-bromo-2-methylphenyl)-2,2,2-trifluoroethyl]piperazine (PubChem CID 171179200) has the molecular formula C13H16BrF3N2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-[(1R)-1-(5-bromo-2-methylphenyl)-2,2,2-trifluoroethyl]piperazine.
| Compound Name | 1-[(1R)-1-(5-bromo-2-methylphenyl)-2,2,2-trifluoroethyl]piperazine |
|---|---|
| PubChem CID | 171179200 |
| Molecular Formula | C13H16BrF3N2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-[(1R)-1-(5-bromo-2-methylphenyl)-2,2,2-trifluoroethyl]piperazine |
| SMILES | Cc1ccc(Br)cc1[C@@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H16BrF3N2/c1-9-2-3-10(14)8-11(9)12(13(15,16)17)19-6-4-18-5-7-19/h2-3,8,12,18H,4-7H2,1H3/t12-/m1/s1 |
| InChIKey | JENCSJJLOOHZCN-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |