C14H19F3N2 — CID 171178089
1-[(1S)-1-(2,5-dimethylphenyl)-2,2,2-trifluoroethyl]piperazine (PubChem CID 171178089) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-[(1S)-1-(2,5-dimethylphenyl)-2,2,2-trifluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,5-dimethylphenyl)-2,2,2-trifluoroethyl]piperazine |
|---|---|
| PubChem CID | 171178089 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[(1S)-1-(2,5-dimethylphenyl)-2,2,2-trifluoroethyl]piperazine |
| SMILES | Cc1ccc(C)c([C@H](N2CCNCC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2/c1-10-3-4-11(2)12(9-10)13(14(15,16)17)19-7-5-18-6-8-19/h3-4,9,13,18H,5-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | WGZMNNWRIKDOBK-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |