C17H19F3N2 — CID 171180294
1-[(1R)-2,2,2-trifluoro-1-(4-methylnaphthalen-1-yl)ethyl]piperazine (PubChem CID 171180294) has the molecular formula C17H19F3N2 and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(4-methylnaphthalen-1-yl)ethyl]piperazine.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(4-methylnaphthalen-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 171180294 |
| Molecular Formula | C17H19F3N2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(4-methylnaphthalen-1-yl)ethyl]piperazine |
| SMILES | Cc1ccc([C@@H](N2CCNCC2)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C17H19F3N2/c1-12-6-7-15(14-5-3-2-4-13(12)14)16(17(18,19)20)22-10-8-21-9-11-22/h2-7,16,21H,8-11H2,1H3/t16-/m1/s1 |
| InChIKey | FUTJHFUUDIQXOP-MRXNPFEDSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |