C17H23ClN2O — CID 171183095
(2S)-2-(4-methylnaphthalen-1-yl)-2-piperazin-1-ylethanol;hydrochloride (PubChem CID 171183095) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is (2S)-2-(4-methylnaphthalen-1-yl)-2-piperazin-1-ylethanol;hydrochloride.
| Compound Name | (2S)-2-(4-methylnaphthalen-1-yl)-2-piperazin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 171183095 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2S)-2-(4-methylnaphthalen-1-yl)-2-piperazin-1-ylethanol;hydrochloride |
| SMILES | Cc1ccc([C@@H](CO)N2CCNCC2)c2ccccc12.Cl |
| InChI | InChI=1S/C17H22N2O.ClH/c1-13-6-7-16(15-5-3-2-4-14(13)15)17(12-20)19-10-8-18-9-11-19;/h2-7,17-18,20H,8-12H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | QSGNUGIUNVKJIV-UNTBIKODSA-N |
| XLogP | 2.51 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |