C16H21Cl2FN2O — CID 171279766
4-[(1R)-2-fluoro-1-piperazin-1-ylethyl]naphthalen-1-ol;dihydrochloride (PubChem CID 171279766) has the molecular formula C16H21Cl2FN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is 4-[(1R)-2-fluoro-1-piperazin-1-ylethyl]naphthalen-1-ol;dihydrochloride.
| Compound Name | 4-[(1R)-2-fluoro-1-piperazin-1-ylethyl]naphthalen-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 171279766 |
| Molecular Formula | C16H21Cl2FN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[(1R)-2-fluoro-1-piperazin-1-ylethyl]naphthalen-1-ol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc([C@H](CF)N2CCNCC2)c2ccccc12 |
| InChI | InChI=1S/C16H19FN2O.2ClH/c17-11-15(19-9-7-18-8-10-19)13-5-6-16(20)14-4-2-1-3-12(13)14;;/h1-6,15,18,20H,7-11H2;2*1H/t15-;;/m0../s1 |
| InChIKey | FQROZHPHRZNEFO-CKUXDGONSA-N |
| XLogP | 3.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |