C16H21ClN2O2 — CID 171183518
4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]naphthalen-1-ol;hydrochloride (PubChem CID 171183518) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]naphthalen-1-ol;hydrochloride.
| Compound Name | 4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]naphthalen-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171183518 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]naphthalen-1-ol;hydrochloride |
| SMILES | Cl.OC[C@@H](c1ccc(O)c2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C16H20N2O2.ClH/c19-11-15(18-9-7-17-8-10-18)13-5-6-16(20)14-4-2-1-3-12(13)14;/h1-6,15,17,19-20H,7-11H2;1H/t15-;/m0./s1 |
| InChIKey | FABKOICCLGFRIN-RSAXXLAASA-N |
| XLogP | 1.91 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |