C19H26N2O2 — CID 171190699
4-[(1R)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-1-ol (PubChem CID 171190699) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(1R)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-1-ol.
| Compound Name | 4-[(1R)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 171190699 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4-[(1R)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-1-ol |
| SMILES | CC(C)(CO)[C@@H](c1ccc(O)c2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C19H26N2O2/c1-19(2,13-22)18(21-11-9-20-10-12-21)16-7-8-17(23)15-6-4-3-5-14(15)16/h3-8,18,20,22-23H,9-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | NRRCMKOPOCPXFF-GOSISDBHSA-N |
| XLogP | 2.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |