C23H29ClN2O — CID 171190386
(3R)-3-anthracen-9-yl-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride (PubChem CID 171190386) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is (3R)-3-anthracen-9-yl-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride.
| Compound Name | (3R)-3-anthracen-9-yl-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171190386 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (3R)-3-anthracen-9-yl-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](c1c2ccccc2cc2ccccc12)N1CCNCC1.Cl |
| InChI | InChI=1S/C23H28N2O.ClH/c1-23(2,16-26)22(25-13-11-24-12-14-25)21-19-9-5-3-7-17(19)15-18-8-4-6-10-20(18)21;/h3-10,15,22,24,26H,11-14,16H2,1-2H3;1H/t22-;/m1./s1 |
| InChIKey | OBSOOZZVYKMWDH-VZYDHVRKSA-N |
| XLogP | 4.38 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|