C20H22ClFN2 — CID 171181642
1-[(1S)-1-anthracen-9-yl-2-fluoroethyl]piperazine;hydrochloride (PubChem CID 171181642) has the molecular formula C20H22ClFN2 and a molecular weight of 344.86 g/mol. Its IUPAC name is 1-[(1S)-1-anthracen-9-yl-2-fluoroethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-anthracen-9-yl-2-fluoroethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181642 |
| Molecular Formula | C20H22ClFN2 |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[(1S)-1-anthracen-9-yl-2-fluoroethyl]piperazine;hydrochloride |
| SMILES | Cl.FC[C@H](c1c2ccccc2cc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C20H21FN2.ClH/c21-14-19(23-11-9-22-10-12-23)20-17-7-3-1-5-15(17)13-16-6-2-4-8-18(16)20;/h1-8,13,19,22H,9-12,14H2;1H/t19-;/m1./s1 |
| InChIKey | PTRPOXRQCXKKGN-FSRHSHDFSA-N |
| XLogP | 4.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|