C21H23Cl2F3N2 — CID 171302274
1-[(1S)-1-anthracen-9-yl-3,3,3-trifluoropropyl]piperazine;dihydrochloride (PubChem CID 171302274) has the molecular formula C21H23Cl2F3N2 and a molecular weight of 431.33 g/mol. Its IUPAC name is 1-[(1S)-1-anthracen-9-yl-3,3,3-trifluoropropyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-anthracen-9-yl-3,3,3-trifluoropropyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171302274 |
| Molecular Formula | C21H23Cl2F3N2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[(1S)-1-anthracen-9-yl-3,3,3-trifluoropropyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)C[C@@H](c1c2ccccc2cc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C21H21F3N2.2ClH/c22-21(23,24)14-19(26-11-9-25-10-12-26)20-17-7-3-1-5-15(17)13-16-6-2-4-8-18(16)20;;/h1-8,13,19,25H,9-12,14H2;2*1H/t19-;;/m0../s1 |
| InChIKey | RYUYQUSOJGGFED-TXEPZDRESA-N |
| XLogP | 5.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|