C22H25Cl2F3N2 — CID 171302275
1-[(1S)-1-anthracen-9-yl-4,4,4-trifluorobutyl]piperazine;dihydrochloride (PubChem CID 171302275) has the molecular formula C22H25Cl2F3N2 and a molecular weight of 445.36 g/mol. Its IUPAC name is 1-[(1S)-1-anthracen-9-yl-4,4,4-trifluorobutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-anthracen-9-yl-4,4,4-trifluorobutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171302275 |
| Molecular Formula | C22H25Cl2F3N2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-[(1S)-1-anthracen-9-yl-4,4,4-trifluorobutyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)CC[C@@H](c1c2ccccc2cc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C22H23F3N2.2ClH/c23-22(24,25)10-9-20(27-13-11-26-12-14-27)21-18-7-3-1-5-16(18)15-17-6-2-4-8-19(17)21;;/h1-8,15,20,26H,9-14H2;2*1H/t20-;;/m0../s1 |
| InChIKey | KUVDEHIGYXQCJV-FJSYBICCSA-N |
| XLogP | 6.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|