C14H19BrClF3N2 — CID 171162714
1-[(1S)-1-(2-bromophenyl)-4,4,4-trifluorobutyl]piperazine;hydrochloride (PubChem CID 171162714) has the molecular formula C14H19BrClF3N2 and a molecular weight of 387.67 g/mol. Its IUPAC name is 1-[(1S)-1-(2-bromophenyl)-4,4,4-trifluorobutyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-bromophenyl)-4,4,4-trifluorobutyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171162714 |
| Molecular Formula | C14H19BrClF3N2 |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-[(1S)-1-(2-bromophenyl)-4,4,4-trifluorobutyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)CC[C@@H](c1ccccc1Br)N1CCNCC1 |
| InChI | InChI=1S/C14H18BrF3N2.ClH/c15-12-4-2-1-3-11(12)13(5-6-14(16,17)18)20-9-7-19-8-10-20;/h1-4,13,19H,5-10H2;1H/t13-;/m0./s1 |
| InChIKey | LMFBUKQGLUWDEA-ZOWNYOTGSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |