C14H19F3N2O — CID 171168760
2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171168760) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171168760 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | Oc1ccccc1[C@@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)6-5-12(19-9-7-18-8-10-19)11-3-1-2-4-13(11)20/h1-4,12,18,20H,5-10H2/t12-/m1/s1 |
| InChIKey | UOFNWBBTDIXVMY-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|