C13H17F4N3 — CID 171303566
1-[(1R)-4,4,4-trifluoro-1-(2-fluoro-3-pyridinyl)butyl]piperazine (PubChem CID 171303566) has the molecular formula C13H17F4N3 and a molecular weight of 291.29 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(2-fluoro-3-pyridinyl)butyl]piperazine.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(2-fluoro-3-pyridinyl)butyl]piperazine |
|---|---|
| PubChem CID | 171303566 |
| Molecular Formula | C13H17F4N3 |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(2-fluoro-3-pyridinyl)butyl]piperazine |
| SMILES | Fc1ncccc1[C@@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H17F4N3/c14-12-10(2-1-5-19-12)11(3-4-13(15,16)17)20-8-6-18-7-9-20/h1-2,5,11,18H,3-4,6-9H2/t11-/m1/s1 |
| InChIKey | GBIGOQAIYUPLRD-LLVKDONJSA-N |
| XLogP | 2.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|