C14H16F6N2 — CID 171171915
1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine (PubChem CID 171171915) has the molecular formula C14H16F6N2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171171915 |
| Molecular Formula | C14H16F6N2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine |
| SMILES | Fc1cc(F)c([C@@H](CCC(F)(F)F)N2CCNCC2)cc1F |
| InChI | InChI=1S/C14H16F6N2/c15-10-8-12(17)11(16)7-9(10)13(1-2-14(18,19)20)22-5-3-21-4-6-22/h7-8,13,21H,1-6H2/t13-/m1/s1 |
| InChIKey | PKVUMBWZBWLLHN-CYBMUJFWSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|