C14H17ClF4N2 — CID 171169817
1-[(1R)-1-(2-chloro-5-fluorophenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171169817) has the molecular formula C14H17ClF4N2 and a molecular weight of 324.75 g/mol. Its IUPAC name is 1-[(1R)-1-(2-chloro-5-fluorophenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-chloro-5-fluorophenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171169817 |
| Molecular Formula | C14H17ClF4N2 |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[(1R)-1-(2-chloro-5-fluorophenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | Fc1ccc(Cl)c([C@@H](CCC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H17ClF4N2/c15-12-2-1-10(16)9-11(12)13(3-4-14(17,18)19)21-7-5-20-6-8-21/h1-2,9,13,20H,3-8H2/t13-/m1/s1 |
| InChIKey | YJTJUDUWBUWBKS-CYBMUJFWSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |