C14H20ClFN2O — CID 171173625
(4R)-4-(2-chloro-5-fluorophenyl)-4-piperazin-1-ylbutan-1-ol (PubChem CID 171173625) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is (4R)-4-(2-chloro-5-fluorophenyl)-4-piperazin-1-ylbutan-1-ol.
| Compound Name | (4R)-4-(2-chloro-5-fluorophenyl)-4-piperazin-1-ylbutan-1-ol |
|---|---|
| PubChem CID | 171173625 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (4R)-4-(2-chloro-5-fluorophenyl)-4-piperazin-1-ylbutan-1-ol |
| SMILES | OCCC[C@H](c1cc(F)ccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C14H20ClFN2O/c15-13-4-3-11(16)10-12(13)14(2-1-9-19)18-7-5-17-6-8-18/h3-4,10,14,17,19H,1-2,5-9H2/t14-/m1/s1 |
| InChIKey | ZBPLWLVZRDLUKG-CQSZACIVSA-N |
| XLogP | 2.20 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |