C12H16ClFN2O — CID 114064745
2-(2-chloro-4-fluorophenyl)-2-piperazin-1-ylethanol (PubChem CID 114064745) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-2-piperazin-1-ylethanol.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 114064745 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-2-piperazin-1-ylethanol |
| SMILES | OCC(c1ccc(F)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C12H16ClFN2O/c13-11-7-9(14)1-2-10(11)12(8-17)16-5-3-15-4-6-16/h1-2,7,12,15,17H,3-6,8H2 |
| InChIKey | IIJXTFTVLQFACI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |