C14H22Cl3FN2 — CID 171289658
1-[(1R)-1-(2-chloro-4-fluorophenyl)butyl]piperazine;dihydrochloride (PubChem CID 171289658) has the molecular formula C14H22Cl3FN2 and a molecular weight of 343.70 g/mol. Its IUPAC name is 1-[(1R)-1-(2-chloro-4-fluorophenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-chloro-4-fluorophenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171289658 |
| Molecular Formula | C14H22Cl3FN2 |
| Molecular Weight | 343.70 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[(1R)-1-(2-chloro-4-fluorophenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1ccc(F)cc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H20ClFN2.2ClH/c1-2-3-14(18-8-6-17-7-9-18)12-5-4-11(16)10-13(12)15;;/h4-5,10,14,17H,2-3,6-9H2,1H3;2*1H/t14-;;/m1../s1 |
| InChIKey | NIUNUASZUMSVHA-FMOMHUKBSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |