C15H21ClF4N2 — CID 171166024
1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride (PubChem CID 171166024) has the molecular formula C15H21ClF4N2 and a molecular weight of 340.79 g/mol. Its IUPAC name is 1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166024 |
| Molecular Formula | C15H21ClF4N2 |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride |
| SMILES | CCC[C@@H](c1ccc(F)cc1C(F)(F)F)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H20F4N2.ClH/c1-2-3-14(21-8-6-20-7-9-21)12-5-4-11(16)10-13(12)15(17,18)19;/h4-5,10,14,20H,2-3,6-9H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | GDDYAZUCJBCSNG-UQKRIMTDSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |