C13H16F4N2 — CID 117109406
1-[1-[4-fluoro-2-(trifluoromethyl)phenyl]ethyl]piperazine (PubChem CID 117109406) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-[1-[4-fluoro-2-(trifluoromethyl)phenyl]ethyl]piperazine.
| Compound Name | 1-[1-[4-fluoro-2-(trifluoromethyl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 117109406 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-[1-[4-fluoro-2-(trifluoromethyl)phenyl]ethyl]piperazine |
| SMILES | CC(c1ccc(F)cc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H16F4N2/c1-9(19-6-4-18-5-7-19)11-3-2-10(14)8-12(11)13(15,16)17/h2-3,8-9,18H,4-7H2,1H3 |
| InChIKey | QPCJRRKVVVZDFW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |