C16H24Cl2F4N2 — CID 171305445
1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171305445) has the molecular formula C16H24Cl2F4N2 and a molecular weight of 391.28 g/mol. Its IUPAC name is 1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305445 |
| Molecular Formula | C16H24Cl2F4N2 |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-[(1S)-1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1ccc(F)cc1C(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H22F4N2.2ClH/c1-3-11(2)15(22-8-6-21-7-9-22)13-5-4-12(17)10-14(13)16(18,19)20;;/h4-5,10-11,15,21H,3,6-9H2,1-2H3;2*1H/t11?,15-;;/m0../s1 |
| InChIKey | QGWQWDURMYGSKZ-QEDFBYNOSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |