C14H20Cl2F4N2 — CID 171279886
1-[(1S)-1-[5-fluoro-2-(trifluoromethyl)phenyl]propyl]piperazine;dihydrochloride (PubChem CID 171279886) has the molecular formula C14H20Cl2F4N2 and a molecular weight of 363.23 g/mol. Its IUPAC name is 1-[(1S)-1-[5-fluoro-2-(trifluoromethyl)phenyl]propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[5-fluoro-2-(trifluoromethyl)phenyl]propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279886 |
| Molecular Formula | C14H20Cl2F4N2 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-[(1S)-1-[5-fluoro-2-(trifluoromethyl)phenyl]propyl]piperazine;dihydrochloride |
| SMILES | CC[C@@H](c1cc(F)ccc1C(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H18F4N2.2ClH/c1-2-13(20-7-5-19-6-8-20)11-9-10(15)3-4-12(11)14(16,17)18;;/h3-4,9,13,19H,2,5-8H2,1H3;2*1H/t13-;;/m0../s1 |
| InChIKey | CENOJKCETGPPTN-GXKRWWSZSA-N |
| XLogP | 4.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |