C15H21F3N2 — CID 3580285
1-[1-[2-(trifluoromethyl)phenyl]propyl]-1,4-diazepane (PubChem CID 3580285) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-[1-[2-(trifluoromethyl)phenyl]propyl]-1,4-diazepane.
| Compound Name | 1-[1-[2-(trifluoromethyl)phenyl]propyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3580285 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[1-[2-(trifluoromethyl)phenyl]propyl]-1,4-diazepane |
| SMILES | CCC(c1ccccc1C(F)(F)F)N1CCCNCC1 |
| InChI | InChI=1S/C15H21F3N2/c1-2-14(20-10-5-8-19-9-11-20)12-6-3-4-7-13(12)15(16,17)18/h3-4,6-7,14,19H,2,5,8-11H2,1H3 |
| InChIKey | DRAHBHPJBFZTQI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |