C16H23F3N2 — CID 171170492
1-[(1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]butyl]piperazine (PubChem CID 171170492) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-[(1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]butyl]piperazine.
| Compound Name | 1-[(1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]butyl]piperazine |
|---|---|
| PubChem CID | 171170492 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[(1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]butyl]piperazine |
| SMILES | CC(C)C[C@H](c1ccccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C16H23F3N2/c1-12(2)11-15(21-9-7-20-8-10-21)13-5-3-4-6-14(13)16(17,18)19/h3-6,12,15,20H,7-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | QJNXLDCVWZYMOL-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |