C17H22F6N2 — CID 171166855
1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbutyl]piperazine (PubChem CID 171166855) has the molecular formula C17H22F6N2 and a molecular weight of 368.37 g/mol. Its IUPAC name is 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171166855 |
| Molecular Formula | C17H22F6N2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@@H](c1ccc(C(F)(F)F)cc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C17H22F6N2/c1-11(2)9-15(25-7-5-24-6-8-25)13-4-3-12(16(18,19)20)10-14(13)17(21,22)23/h3-4,10-11,15,24H,5-9H2,1-2H3/t15-/m0/s1 |
| InChIKey | DLCHOGVRMUZOEI-HNNXBMFYSA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |