C17H20F6N2 — CID 171293186
1-[(1R)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbut-3-enyl]piperazine (PubChem CID 171293186) has the molecular formula C17H20F6N2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 1-[(1R)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbut-3-enyl]piperazine.
| Compound Name | 1-[(1R)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbut-3-enyl]piperazine |
|---|---|
| PubChem CID | 171293186 |
| Molecular Formula | C17H20F6N2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(1R)-1-[2,4-bis(trifluoromethyl)phenyl]-3-methylbut-3-enyl]piperazine |
| SMILES | C=C(C)C[C@H](c1ccc(C(F)(F)F)cc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C17H20F6N2/c1-11(2)9-15(25-7-5-24-6-8-25)13-4-3-12(16(18,19)20)10-14(13)17(21,22)23/h3-4,10,15,24H,1,5-9H2,2H3/t15-/m1/s1 |
| InChIKey | GDYVJIONENKUTA-OAHLLOKOSA-N |
| XLogP | 4.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|