C14H17ClF6N2 — CID 171166814
1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride (PubChem CID 171166814) has the molecular formula C14H17ClF6N2 and a molecular weight of 362.75 g/mol. Its IUPAC name is 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166814 |
| Molecular Formula | C14H17ClF6N2 |
| Molecular Weight | 362.75 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride |
| SMILES | C[C@@H](c1ccc(C(F)(F)F)cc1C(F)(F)F)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H16F6N2.ClH/c1-9(22-6-4-21-5-7-22)11-3-2-10(13(15,16)17)8-12(11)14(18,19)20;/h2-3,8-9,21H,4-7H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | VAUIKLAOKBOGLD-FVGYRXGTSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |