C15H18Cl2F6N2 — CID 171280542
1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171280542) has the molecular formula C15H18Cl2F6N2 and a molecular weight of 411.22 g/mol. Its IUPAC name is 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171280542 |
| Molecular Formula | C15H18Cl2F6N2 |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 1-[(1S)-1-[2,4-bis(trifluoromethyl)phenyl]prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@@H](c1ccc(C(F)(F)F)cc1C(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H16F6N2.2ClH/c1-2-13(23-7-5-22-6-8-23)11-4-3-10(14(16,17)18)9-12(11)15(19,20)21;;/h2-4,9,13,22H,1,5-8H2;2*1H/t13-;;/m0../s1 |
| InChIKey | LYZCMZPEPWLTII-GXKRWWSZSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|