C14H19Cl2F3N2O — CID 171299039
2-[(1S)-1-piperazin-1-ylprop-2-enyl]-4-(trifluoromethyl)phenol;dihydrochloride (PubChem CID 171299039) has the molecular formula C14H19Cl2F3N2O and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-[(1S)-1-piperazin-1-ylprop-2-enyl]-4-(trifluoromethyl)phenol;dihydrochloride.
| Compound Name | 2-[(1S)-1-piperazin-1-ylprop-2-enyl]-4-(trifluoromethyl)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171299039 |
| Molecular Formula | C14H19Cl2F3N2O |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[(1S)-1-piperazin-1-ylprop-2-enyl]-4-(trifluoromethyl)phenol;dihydrochloride |
| SMILES | C=C[C@@H](c1cc(C(F)(F)F)ccc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H17F3N2O.2ClH/c1-2-12(19-7-5-18-6-8-19)11-9-10(14(15,16)17)3-4-13(11)20;;/h2-4,9,12,18,20H,1,5-8H2;2*1H/t12-;;/m0../s1 |
| InChIKey | UWJQZHHZVIISIY-LTCKWSDVSA-N |
| XLogP | 3.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|