C14H15ClF4N2 — CID 171166065
1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enyl]piperazine (PubChem CID 171166065) has the molecular formula C14H15ClF4N2 and a molecular weight of 322.73 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171166065 |
| Molecular Formula | C14H15ClF4N2 |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enyl]piperazine |
| SMILES | C=C[C@@H](c1cc(C(F)(F)F)cc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C14H15ClF4N2/c1-2-12(21-5-3-20-4-6-21)10-7-9(14(17,18)19)8-11(15)13(10)16/h2,7-8,12,20H,1,3-6H2/t12-/m0/s1 |
| InChIKey | ZZUMTZUGOOOZBT-LBPRGKRZSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|