C16H19ClF4N2 — CID 171279959
1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine (PubChem CID 171279959) has the molecular formula C16H19ClF4N2 and a molecular weight of 350.79 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171279959 |
| Molecular Formula | C16H19ClF4N2 |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1cc(C(F)(F)F)cc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C16H19ClF4N2/c1-2-3-4-14(23-7-5-22-6-8-23)12-9-11(16(19,20)21)10-13(17)15(12)18/h2,9-10,14,22H,1,3-8H2/t14-/m0/s1 |
| InChIKey | LEQOVWIWKNGODM-AWEZNQCLSA-N |
| XLogP | 4.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|