C17H21Cl2F7N2 — CID 171296681
1-[(1R)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171296681) has the molecular formula C17H21Cl2F7N2 and a molecular weight of 457.26 g/mol. Its IUPAC name is 1-[(1R)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171296681 |
| Molecular Formula | C17H21Cl2F7N2 |
| Molecular Weight | 457.26 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-[(1R)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@H](c1c(F)cc(C(F)(F)F)cc1C(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H19F7N2.2ClH/c1-2-3-4-14(26-7-5-25-6-8-26)15-12(17(22,23)24)9-11(10-13(15)18)16(19,20)21;;/h2,9-10,14,25H,1,3-8H2;2*1H/t14-;;/m1../s1 |
| InChIKey | STFPSMRXHQHJHS-FMOMHUKBSA-N |
| XLogP | 5.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|