C17H21ClF6N2O — CID 171172732
1-[(1R)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride (PubChem CID 171172732) has the molecular formula C17H21ClF6N2O and a molecular weight of 418.81 g/mol. Its IUPAC name is 1-[(1R)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172732 |
| Molecular Formula | C17H21ClF6N2O |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-[(1R)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@H](c1c(OC)cc(C(F)(F)F)cc1C(F)(F)F)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H20F6N2O.ClH/c1-3-4-13(25-7-5-24-6-8-25)15-12(17(21,22)23)9-11(16(18,19)20)10-14(15)26-2;/h3,9-10,13,24H,1,4-8H2,2H3;1H/t13-;/m1./s1 |
| InChIKey | CKVHMKWPAYLXKN-BTQNPOSSSA-N |
| XLogP | 4.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|