C16H26Cl2N2O3 — CID 171286402
2,6-dimethoxy-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride (PubChem CID 171286402) has the molecular formula C16H26Cl2N2O3 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride.
| Compound Name | 2,6-dimethoxy-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171286402 |
| Molecular Formula | C16H26Cl2N2O3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2,6-dimethoxy-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
| SMILES | C=CC[C@H](c1cc(OC)c(O)c(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O3.2ClH/c1-4-5-13(18-8-6-17-7-9-18)12-10-14(20-2)16(19)15(11-12)21-3;;/h4,10-11,13,17,19H,1,5-9H2,2-3H3;2*1H/t13-;;/m1../s1 |
| InChIKey | VFMFWZMZGTUSDS-FFXKMJQXSA-N |
| XLogP | 2.78 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|