C18H32Cl2N2O3 — CID 171308702
2,6-dimethoxy-4-[(1S)-1-piperazin-1-ylhexyl]phenol;dihydrochloride (PubChem CID 171308702) has the molecular formula C18H32Cl2N2O3 and a molecular weight of 395.37 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(1S)-1-piperazin-1-ylhexyl]phenol;dihydrochloride.
| Compound Name | 2,6-dimethoxy-4-[(1S)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171308702 |
| Molecular Formula | C18H32Cl2N2O3 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2,6-dimethoxy-4-[(1S)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
| SMILES | CCCCC[C@@H](c1cc(OC)c(O)c(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H30N2O3.2ClH/c1-4-5-6-7-15(20-10-8-19-9-11-20)14-12-16(22-2)18(21)17(13-14)23-3;;/h12-13,15,19,21H,4-11H2,1-3H3;2*1H/t15-;;/m0../s1 |
| InChIKey | JFTOUFCTMTVZOY-CKUXDGONSA-N |
| XLogP | 3.78 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|