C17H30Cl2N2O — CID 171307810
2,6-dimethyl-4-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride (PubChem CID 171307810) has the molecular formula C17H30Cl2N2O and a molecular weight of 349.35 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride.
| Compound Name | 2,6-dimethyl-4-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307810 |
| Molecular Formula | C17H30Cl2N2O |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2,6-dimethyl-4-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
| SMILES | CCCC[C@H](c1cc(C)c(O)c(C)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H28N2O.2ClH/c1-4-5-6-16(19-9-7-18-8-10-19)15-11-13(2)17(20)14(3)12-15;;/h11-12,16,18,20H,4-10H2,1-3H3;2*1H/t16-;;/m1../s1 |
| InChIKey | SEKSPZYISKKMQT-GGMCWBHBSA-N |
| XLogP | 3.99 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |