C17H29BrCl2N2O2 — CID 171307896
2-bromo-6-methoxy-4-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride (PubChem CID 171307896) has the molecular formula C17H29BrCl2N2O2 and a molecular weight of 444.24 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride.
| Compound Name | 2-bromo-6-methoxy-4-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307896 |
| Molecular Formula | C17H29BrCl2N2O2 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
| SMILES | CCCCC[C@H](c1cc(Br)c(O)c(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H27BrN2O2.2ClH/c1-3-4-5-6-15(20-9-7-19-8-10-20)13-11-14(18)17(21)16(12-13)22-2;;/h11-12,15,19,21H,3-10H2,1-2H3;2*1H/t15-;;/m1../s1 |
| InChIKey | PLGUIXNZIXYDBR-QCUBGVIVSA-N |
| XLogP | 4.53 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|