C16H25N3O4 — CID 171307979
2-methoxy-6-nitro-4-[(1R)-1-piperazin-1-ylpentyl]phenol (PubChem CID 171307979) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[(1R)-1-piperazin-1-ylpentyl]phenol.
| Compound Name | 2-methoxy-6-nitro-4-[(1R)-1-piperazin-1-ylpentyl]phenol |
|---|---|
| PubChem CID | 171307979 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-methoxy-6-nitro-4-[(1R)-1-piperazin-1-ylpentyl]phenol |
| SMILES | CCCC[C@H](c1cc(OC)c(O)c([N+](=O)[O-])c1)N1CCNCC1 |
| InChI | InChI=1S/C16H25N3O4/c1-3-4-5-13(18-8-6-17-7-9-18)12-10-14(19(21)22)16(20)15(11-12)23-2/h10-11,13,17,20H,3-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | SECOCKVARSYYIC-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|