C13H21Cl2N3O4 — CID 171279403
2-methoxy-6-nitro-4-[(1S)-1-piperazin-1-ylethyl]phenol;dihydrochloride (PubChem CID 171279403) has the molecular formula C13H21Cl2N3O4 and a molecular weight of 354.23 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[(1S)-1-piperazin-1-ylethyl]phenol;dihydrochloride.
| Compound Name | 2-methoxy-6-nitro-4-[(1S)-1-piperazin-1-ylethyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171279403 |
| Molecular Formula | C13H21Cl2N3O4 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-methoxy-6-nitro-4-[(1S)-1-piperazin-1-ylethyl]phenol;dihydrochloride |
| SMILES | COc1cc([C@H](C)N2CCNCC2)cc([N+](=O)[O-])c1O.Cl.Cl |
| InChI | InChI=1S/C13H19N3O4.2ClH/c1-9(15-5-3-14-4-6-15)10-7-11(16(18)19)13(17)12(8-10)20-2;;/h7-9,14,17H,3-6H2,1-2H3;2*1H/t9-;;/m0../s1 |
| InChIKey | KDFPDDHFAHUQMF-WWPIYYJJSA-N |
| XLogP | 2.12 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|