C14H20Cl2N4O4 — CID 171306169
(3S)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306169) has the molecular formula C14H20Cl2N4O4 and a molecular weight of 379.24 g/mol. Its IUPAC name is (3S)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3S)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306169 |
| Molecular Formula | C14H20Cl2N4O4 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (3S)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | COc1cc([C@H](CC#N)N2CCNCC2)cc([N+](=O)[O-])c1O.Cl.Cl |
| InChI | InChI=1S/C14H18N4O4.2ClH/c1-22-13-9-10(8-12(14(13)19)18(20)21)11(2-3-15)17-6-4-16-5-7-17;;/h8-9,11,16,19H,2,4-7H2,1H3;2*1H/t11-;;/m0../s1 |
| InChIKey | NCGMIMRLNGFDRK-IDMXKUIJSA-N |
| XLogP | 2.01 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|