C14H20BrCl2N3O2 — CID 171306332
(3S)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306332) has the molecular formula C14H20BrCl2N3O2 and a molecular weight of 413.14 g/mol. Its IUPAC name is (3S)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3S)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306332 |
| Molecular Formula | C14H20BrCl2N3O2 |
| Molecular Weight | 413.14 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (3S)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | COc1cc(Br)cc([C@H](CC#N)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C14H18BrN3O2.2ClH/c1-20-13-9-10(15)8-11(14(13)19)12(2-3-16)18-6-4-17-5-7-18;;/h8-9,12,17,19H,2,4-7H2,1H3;2*1H/t12-;;/m0../s1 |
| InChIKey | WUDGRTYUBBUERD-LTCKWSDVSA-N |
| XLogP | 2.87 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|