C15H20BrF3N2O2 — CID 171172565
4-bromo-2-methoxy-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171172565) has the molecular formula C15H20BrF3N2O2 and a molecular weight of 397.24 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 4-bromo-2-methoxy-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171172565 |
| Molecular Formula | C15H20BrF3N2O2 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-bromo-2-methoxy-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | COc1cc(Br)cc([C@@H](CCC(F)(F)F)N2CCNCC2)c1O |
| InChI | InChI=1S/C15H20BrF3N2O2/c1-23-13-9-10(16)8-11(14(13)22)12(2-3-15(17,18)19)21-6-4-20-5-7-21/h8-9,12,20,22H,2-7H2,1H3/t12-/m1/s1 |
| InChIKey | ZRUHMVDNXZLABU-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|